C18H15N3O5 — CID 4179988
ethyl 3-[(4-nitrobenzoyl)amino]-1H-indole-2-carboxylate (PubChem CID 4179988) has the molecular formula C18H15N3O5 and a molecular weight of 353.33 g/mol. Its IUPAC name is ethyl 3-[(4-nitrobenzoyl)amino]-1H-indole-2-carboxylate.
| Compound Name | ethyl 3-[(4-nitrobenzoyl)amino]-1H-indole-2-carboxylate |
|---|---|
| PubChem CID | 4179988 |
| Molecular Formula | C18H15N3O5 |
| Molecular Weight | 353.33 g/mol |
| Exact Mass | 353.10 |
| IUPAC Name | ethyl 3-[(4-nitrobenzoyl)amino]-1H-indole-2-carboxylate |
| SMILES | CCOC(=O)c1[nH]c2ccccc2c1NC(=O)c1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C18H15N3O5/c1-2-26-18(23)16-15(13-5-3-4-6-14(13)19-16)20-17(22)11-7-9-12(10-8-11)21(24)25/h3-10,19H,2H2,1H3,(H,20,22) |
| InChIKey | ACCAVOXUDUXKJY-UHFFFAOYSA-N |
| XLogP | 3.51 |
| TPSA | 114.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.33 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|