C28H32N4O8 — CID 51063119
1,4-dioxane;bis(4-(oxiran-2-ylmethoxy)-1H-indole-2-carboxamide) (PubChem CID 51063119) has the molecular formula C28H32N4O8 and a molecular weight of 552.58 g/mol. Its IUPAC name is 1,4-dioxane;bis(4-(oxiran-2-ylmethoxy)-1H-indole-2-carboxamide).
| Compound Name | 1,4-dioxane;bis(4-(oxiran-2-ylmethoxy)-1H-indole-2-carboxamide) |
|---|---|
| PubChem CID | 51063119 |
| Molecular Formula | C28H32N4O8 |
| Molecular Weight | 552.58 g/mol |
| Exact Mass | 552.22 |
| IUPAC Name | 1,4-dioxane;bis(4-(oxiran-2-ylmethoxy)-1H-indole-2-carboxamide) |
| SMILES | C1COCCO1.NC(=O)c1cc2c(OCC3CO3)cccc2[nH]1.NC(=O)c1cc2c(OCC3CO3)cccc2[nH]1 |
| InChI | InChI=1S/2C12H12N2O3.C4H8O2/c2*13-12(15)10-4-8-9(14-10)2-1-3-11(8)17-6-7-5-16-7;1-2-6-4-3-5-1/h2*1-4,7,14H,5-6H2,(H2,13,15);1-4H2 |
| InChIKey | DJJFSOXZYMGKDH-UHFFFAOYSA-N |
| XLogP | 2.12 |
| TPSA | 179.74 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 552.58 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|