C22H21NO5 — CID 10970901
3,4-dimethoxy-N-[5-(oxiran-2-ylmethoxy)naphthalen-1-yl]benzamide (PubChem CID 10970901) has the molecular formula C22H21NO5 and a molecular weight of 379.41 g/mol. Its IUPAC name is 3,4-dimethoxy-N-[5-(oxiran-2-ylmethoxy)naphthalen-1-yl]benzamide.
| Compound Name | 3,4-dimethoxy-N-[5-(oxiran-2-ylmethoxy)naphthalen-1-yl]benzamide |
|---|---|
| PubChem CID | 10970901 |
| Molecular Formula | C22H21NO5 |
| Molecular Weight | 379.41 g/mol |
| Exact Mass | 379.14 |
| IUPAC Name | 3,4-dimethoxy-N-[5-(oxiran-2-ylmethoxy)naphthalen-1-yl]benzamide |
| SMILES | COc1ccc(C(=O)Nc2cccc3c(OCC4CO4)cccc23)cc1OC |
| InChI | InChI=1S/C22H21NO5/c1-25-20-10-9-14(11-21(20)26-2)22(24)23-18-7-3-6-17-16(18)5-4-8-19(17)28-13-15-12-27-15/h3-11,15H,12-13H2,1-2H3,(H,23,24) |
| InChIKey | CAZUPJAJWSPOSR-UHFFFAOYSA-N |
| XLogP | 3.89 |
| TPSA | 69.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.41 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|