C19H21NO6 — CID 11100457
3,4,5-trimethoxy-N-[4-(oxiran-2-ylmethoxy)phenyl]benzamide (PubChem CID 11100457) has the molecular formula C19H21NO6 and a molecular weight of 359.38 g/mol. Its IUPAC name is 3,4,5-trimethoxy-N-[4-(oxiran-2-ylmethoxy)phenyl]benzamide.
| Compound Name | 3,4,5-trimethoxy-N-[4-(oxiran-2-ylmethoxy)phenyl]benzamide |
|---|---|
| PubChem CID | 11100457 |
| Molecular Formula | C19H21NO6 |
| Molecular Weight | 359.38 g/mol |
| Exact Mass | 359.14 |
| IUPAC Name | 3,4,5-trimethoxy-N-[4-(oxiran-2-ylmethoxy)phenyl]benzamide |
| SMILES | COc1cc(C(=O)Nc2ccc(OCC3CO3)cc2)cc(OC)c1OC |
| InChI | InChI=1S/C19H21NO6/c1-22-16-8-12(9-17(23-2)18(16)24-3)19(21)20-13-4-6-14(7-5-13)25-10-15-11-26-15/h4-9,15H,10-11H2,1-3H3,(H,20,21) |
| InChIKey | FQBQINGLHYIPPL-UHFFFAOYSA-N |
| XLogP | 2.74 |
| TPSA | 78.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.38 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|