C21H21NO5 — CID 1150730
3,4,5-trimethoxy-N-[4-(5-methylfuran-2-yl)phenyl]benzamide (PubChem CID 1150730) has the molecular formula C21H21NO5 and a molecular weight of 367.40 g/mol. Its IUPAC name is 3,4,5-trimethoxy-N-[4-(5-methylfuran-2-yl)phenyl]benzamide.
| Compound Name | 3,4,5-trimethoxy-N-[4-(5-methylfuran-2-yl)phenyl]benzamide |
|---|---|
| PubChem CID | 1150730 |
| Molecular Formula | C21H21NO5 |
| Molecular Weight | 367.40 g/mol |
| Exact Mass | 367.14 |
| IUPAC Name | 3,4,5-trimethoxy-N-[4-(5-methylfuran-2-yl)phenyl]benzamide |
| SMILES | COc1cc(C(=O)Nc2ccc(-c3ccc(C)o3)cc2)cc(OC)c1OC |
| InChI | InChI=1S/C21H21NO5/c1-13-5-10-17(27-13)14-6-8-16(9-7-14)22-21(23)15-11-18(24-2)20(26-4)19(12-15)25-3/h5-12H,1-4H3,(H,22,23) |
| InChIKey | VNHSOFGLCCNFOP-UHFFFAOYSA-N |
| XLogP | 4.53 |
| TPSA | 69.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.40 |
| LogP ≤ 5 | 4.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |