C20H17NO6 — CID 23967867
5-[4-[(3,4-dimethoxybenzoyl)amino]phenyl]furan-2-carboxylic acid (PubChem CID 23967867) has the molecular formula C20H17NO6 and a molecular weight of 367.36 g/mol. Its IUPAC name is 5-[4-[(3,4-dimethoxybenzoyl)amino]phenyl]furan-2-carboxylic acid.
| Compound Name | 5-[4-[(3,4-dimethoxybenzoyl)amino]phenyl]furan-2-carboxylic acid |
|---|---|
| PubChem CID | 23967867 |
| Molecular Formula | C20H17NO6 |
| Molecular Weight | 367.36 g/mol |
| Exact Mass | 367.11 |
| IUPAC Name | 5-[4-[(3,4-dimethoxybenzoyl)amino]phenyl]furan-2-carboxylic acid |
| SMILES | COc1ccc(C(=O)Nc2ccc(-c3ccc(C(=O)O)o3)cc2)cc1OC |
| InChI | InChI=1S/C20H17NO6/c1-25-16-8-5-13(11-18(16)26-2)19(22)21-14-6-3-12(4-7-14)15-9-10-17(27-15)20(23)24/h3-11H,1-2H3,(H,21,22)(H,23,24) |
| InChIKey | CCZWTBAQMNAYPR-UHFFFAOYSA-N |
| XLogP | 3.91 |
| TPSA | 98.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.36 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |