C10H12N2O3 — CID 86760859
[2-[[(2R)-oxiran-2-yl]methoxy]phenyl]urea (PubChem CID 86760859) has the molecular formula C10H12N2O3 and a molecular weight of 208.22 g/mol. Its IUPAC name is [2-[[(2R)-oxiran-2-yl]methoxy]phenyl]urea.
| Compound Name | [2-[[(2R)-oxiran-2-yl]methoxy]phenyl]urea |
|---|---|
| PubChem CID | 86760859 |
| Molecular Formula | C10H12N2O3 |
| Molecular Weight | 208.22 g/mol |
| Exact Mass | 208.08 |
| IUPAC Name | [2-[[(2R)-oxiran-2-yl]methoxy]phenyl]urea |
| SMILES | NC(=O)Nc1ccccc1OC[C@H]1CO1 |
| InChI | InChI=1S/C10H12N2O3/c11-10(13)12-8-3-1-2-4-9(8)15-6-7-5-14-7/h1-4,7H,5-6H2,(H3,11,12,13)/t7-/m1/s1 |
| InChIKey | SRPBPKZUTGSHCS-SSDOTTSWSA-N |
| XLogP | 0.95 |
| TPSA | 76.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 208.22 |
| LogP ≤ 5 | 0.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|