C15H25NO5 — CID 157082570
tert-butyl carbamate;2-[(2-methoxyphenoxy)methyl]oxirane;molecular hydrogen (PubChem CID 157082570) has the molecular formula C15H25NO5 and a molecular weight of 299.37 g/mol. Its IUPAC name is tert-butyl carbamate;2-[(2-methoxyphenoxy)methyl]oxirane;molecular hydrogen.
| Compound Name | tert-butyl carbamate;2-[(2-methoxyphenoxy)methyl]oxirane;molecular hydrogen |
|---|---|
| PubChem CID | 157082570 |
| Molecular Formula | C15H25NO5 |
| Molecular Weight | 299.37 g/mol |
| Exact Mass | 299.17 |
| IUPAC Name | tert-butyl carbamate;2-[(2-methoxyphenoxy)methyl]oxirane;molecular hydrogen |
| SMILES | CC(C)(C)OC(N)=O.COc1ccccc1OCC1CO1.[H][H] |
| InChI | InChI=1S/C10H12O3.C5H11NO2.H2/c1-11-9-4-2-3-5-10(9)13-7-8-6-12-8;1-5(2,3)8-4(6)7;/h2-5,8H,6-7H2,1H3;1-3H3,(H2,6,7);1H |
| InChIKey | ADSJSMAILWYSCM-UHFFFAOYSA-N |
| XLogP | 2.60 |
| TPSA | 83.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.37 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|