C12H15BrO4 — CID 19762930
4-(bromomethyl)-2-[(2-methoxyphenoxy)methyl]-1,3-dioxolane (PubChem CID 19762930) has the molecular formula C12H15BrO4 and a molecular weight of 303.15 g/mol. Its IUPAC name is 4-(bromomethyl)-2-[(2-methoxyphenoxy)methyl]-1,3-dioxolane.
| Compound Name | 4-(bromomethyl)-2-[(2-methoxyphenoxy)methyl]-1,3-dioxolane |
|---|---|
| PubChem CID | 19762930 |
| Molecular Formula | C12H15BrO4 |
| Molecular Weight | 303.15 g/mol |
| Exact Mass | 302.02 |
| IUPAC Name | 4-(bromomethyl)-2-[(2-methoxyphenoxy)methyl]-1,3-dioxolane |
| SMILES | COc1ccccc1OCC1OCC(CBr)O1 |
| InChI | InChI=1S/C12H15BrO4/c1-14-10-4-2-3-5-11(10)15-8-12-16-7-9(6-13)17-12/h2-5,9,12H,6-8H2,1H3 |
| InChIKey | XBLUSVUABUQSFO-UHFFFAOYSA-N |
| XLogP | 2.21 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.15 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|