C11H14O3 — CID 89175993
2-methyl-4-[(2-methylphenoxy)methyl]-1,3-dioxetane (PubChem CID 89175993) has the molecular formula C11H14O3 and a molecular weight of 194.23 g/mol. Its IUPAC name is 2-methyl-4-[(2-methylphenoxy)methyl]-1,3-dioxetane.
| Compound Name | 2-methyl-4-[(2-methylphenoxy)methyl]-1,3-dioxetane |
|---|---|
| PubChem CID | 89175993 |
| Molecular Formula | C11H14O3 |
| Molecular Weight | 194.23 g/mol |
| Exact Mass | 194.09 |
| IUPAC Name | 2-methyl-4-[(2-methylphenoxy)methyl]-1,3-dioxetane |
| SMILES | Cc1ccccc1OCC1OC(C)O1 |
| InChI | InChI=1S/C11H14O3/c1-8-5-3-4-6-10(8)12-7-11-13-9(2)14-11/h3-6,9,11H,7H2,1-2H3 |
| InChIKey | OHVOMHMHVSBPDB-UHFFFAOYSA-N |
| XLogP | 2.09 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 194.23 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |