C12H15BrO3S — CID 19762934
2-(bromomethyl)-5-[(2-methoxyphenoxy)methyl]-1,3-oxathiolane (PubChem CID 19762934) has the molecular formula C12H15BrO3S and a molecular weight of 319.22 g/mol. Its IUPAC name is 2-(bromomethyl)-5-[(2-methoxyphenoxy)methyl]-1,3-oxathiolane.
| Compound Name | 2-(bromomethyl)-5-[(2-methoxyphenoxy)methyl]-1,3-oxathiolane |
|---|---|
| PubChem CID | 19762934 |
| Molecular Formula | C12H15BrO3S |
| Molecular Weight | 319.22 g/mol |
| Exact Mass | 317.99 |
| IUPAC Name | 2-(bromomethyl)-5-[(2-methoxyphenoxy)methyl]-1,3-oxathiolane |
| SMILES | COc1ccccc1OCC1CSC(CBr)O1 |
| InChI | InChI=1S/C12H15BrO3S/c1-14-10-4-2-3-5-11(10)15-7-9-8-17-12(6-13)16-9/h2-5,9,12H,6-8H2,1H3 |
| InChIKey | PKCSMDGQYLPBTL-UHFFFAOYSA-N |
| XLogP | 2.93 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.22 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|