C11H15NO2S — CID 139643561
2-deuterio-2-[(2-methoxyphenoxy)methyl]-1,3-thiazolidine (PubChem CID 139643561) has the molecular formula C11H15NO2S and a molecular weight of 226.32 g/mol. Its IUPAC name is 2-deuterio-2-[(2-methoxyphenoxy)methyl]-1,3-thiazolidine.
| Compound Name | 2-deuterio-2-[(2-methoxyphenoxy)methyl]-1,3-thiazolidine |
|---|---|
| PubChem CID | 139643561 |
| Molecular Formula | C11H15NO2S |
| Molecular Weight | 226.32 g/mol |
| Exact Mass | 226.09 |
| IUPAC Name | 2-deuterio-2-[(2-methoxyphenoxy)methyl]-1,3-thiazolidine |
| SMILES | [2H]C1(COc2ccccc2OC)NCCS1 |
| InChI | InChI=1S/C11H15NO2S/c1-13-9-4-2-3-5-10(9)14-8-11-12-6-7-15-11/h2-5,11-12H,6-8H2,1H3/i11D |
| InChIKey | RVDKSQDMEIWCNB-WORMITQPSA-N |
| XLogP | 1.74 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.32 |
| LogP ≤ 5 | 1.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |