C16H17NO2 — CID 115104609
1-[(2-methoxyphenoxy)methyl]-2,3-dihydro-1H-isoindole (PubChem CID 115104609) has the molecular formula C16H17NO2 and a molecular weight of 255.32 g/mol. Its IUPAC name is 1-[(2-methoxyphenoxy)methyl]-2,3-dihydro-1H-isoindole.
| Compound Name | 1-[(2-methoxyphenoxy)methyl]-2,3-dihydro-1H-isoindole |
|---|---|
| PubChem CID | 115104609 |
| Molecular Formula | C16H17NO2 |
| Molecular Weight | 255.32 g/mol |
| Exact Mass | 255.13 |
| IUPAC Name | 1-[(2-methoxyphenoxy)methyl]-2,3-dihydro-1H-isoindole |
| SMILES | COc1ccccc1OCC1NCc2ccccc21 |
| InChI | InChI=1S/C16H17NO2/c1-18-15-8-4-5-9-16(15)19-11-14-13-7-3-2-6-12(13)10-17-14/h2-9,14,17H,10-11H2,1H3 |
| InChIKey | KDHABIVYWOOJFA-UHFFFAOYSA-N |
| XLogP | 2.92 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.32 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |