C15H16N2O — CID 129404358
(2R)-2-(2-methoxyphenyl)-1,2,3,4-tetrahydroquinazoline (PubChem CID 129404358) has the molecular formula C15H16N2O and a molecular weight of 240.31 g/mol. Its IUPAC name is (2R)-2-(2-methoxyphenyl)-1,2,3,4-tetrahydroquinazoline.
| Compound Name | (2R)-2-(2-methoxyphenyl)-1,2,3,4-tetrahydroquinazoline |
|---|---|
| PubChem CID | 129404358 |
| Molecular Formula | C15H16N2O |
| Molecular Weight | 240.31 g/mol |
| Exact Mass | 240.13 |
| IUPAC Name | (2R)-2-(2-methoxyphenyl)-1,2,3,4-tetrahydroquinazoline |
| SMILES | COc1ccccc1[C@@H]1NCc2ccccc2N1 |
| InChI | InChI=1S/C15H16N2O/c1-18-14-9-5-3-7-12(14)15-16-10-11-6-2-4-8-13(11)17-15/h2-9,15-17H,10H2,1H3/t15-/m1/s1 |
| InChIKey | NJSVNEYHITUQSI-OAHLLOKOSA-N |
| XLogP | 2.91 |
| TPSA | 33.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.31 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |