C15H14FNO — CID 84737138
5-fluoro-1-(2-methoxyphenyl)-2,3-dihydro-1H-isoindole (PubChem CID 84737138) has the molecular formula C15H14FNO and a molecular weight of 243.28 g/mol. Its IUPAC name is 5-fluoro-1-(2-methoxyphenyl)-2,3-dihydro-1H-isoindole.
| Compound Name | 5-fluoro-1-(2-methoxyphenyl)-2,3-dihydro-1H-isoindole |
|---|---|
| PubChem CID | 84737138 |
| Molecular Formula | C15H14FNO |
| Molecular Weight | 243.28 g/mol |
| Exact Mass | 243.11 |
| IUPAC Name | 5-fluoro-1-(2-methoxyphenyl)-2,3-dihydro-1H-isoindole |
| SMILES | COc1ccccc1C1NCc2cc(F)ccc21 |
| InChI | InChI=1S/C15H14FNO/c1-18-14-5-3-2-4-13(14)15-12-7-6-11(16)8-10(12)9-17-15/h2-8,15,17H,9H2,1H3 |
| InChIKey | KEEYKAZMODXKOV-UHFFFAOYSA-N |
| XLogP | 3.03 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.28 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |