C15H13F2N — CID 107514282
1-(2,3-difluoro-4-methylphenyl)-2,3-dihydro-1H-isoindole (PubChem CID 107514282) has the molecular formula C15H13F2N and a molecular weight of 245.27 g/mol. Its IUPAC name is 1-(2,3-difluoro-4-methylphenyl)-2,3-dihydro-1H-isoindole.
| Compound Name | 1-(2,3-difluoro-4-methylphenyl)-2,3-dihydro-1H-isoindole |
|---|---|
| PubChem CID | 107514282 |
| Molecular Formula | C15H13F2N |
| Molecular Weight | 245.27 g/mol |
| Exact Mass | 245.10 |
| IUPAC Name | 1-(2,3-difluoro-4-methylphenyl)-2,3-dihydro-1H-isoindole |
| SMILES | Cc1ccc(C2NCc3ccccc32)c(F)c1F |
| InChI | InChI=1S/C15H13F2N/c1-9-6-7-12(14(17)13(9)16)15-11-5-3-2-4-10(11)8-18-15/h2-7,15,18H,8H2,1H3 |
| InChIKey | CHMXMUNNHQOZGC-UHFFFAOYSA-N |
| XLogP | 3.47 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.27 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |