C17H14N2 — CID 81224395
8-(2,3-dihydro-1H-isoindol-1-yl)quinoline (PubChem CID 81224395) has the molecular formula C17H14N2 and a molecular weight of 246.31 g/mol. Its IUPAC name is 8-(2,3-dihydro-1H-isoindol-1-yl)quinoline.
| Compound Name | 8-(2,3-dihydro-1H-isoindol-1-yl)quinoline |
|---|---|
| PubChem CID | 81224395 |
| Molecular Formula | C17H14N2 |
| Molecular Weight | 246.31 g/mol |
| Exact Mass | 246.12 |
| IUPAC Name | 8-(2,3-dihydro-1H-isoindol-1-yl)quinoline |
| SMILES | c1ccc2c(c1)CNC2c1cccc2cccnc12 |
| InChI | InChI=1S/C17H14N2/c1-2-8-14-13(5-1)11-19-17(14)15-9-3-6-12-7-4-10-18-16(12)15/h1-10,17,19H,11H2 |
| InChIKey | QSTGXFAOEBXDGX-UHFFFAOYSA-N |
| XLogP | 3.43 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.31 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |