C12H16O4 — CID 115094665
[2-[(2-methoxyphenyl)methyl]-1,3-dioxolan-4-yl]methanol (PubChem CID 115094665) has the molecular formula C12H16O4 and a molecular weight of 224.26 g/mol. Its IUPAC name is [2-[(2-methoxyphenyl)methyl]-1,3-dioxolan-4-yl]methanol.
| Compound Name | [2-[(2-methoxyphenyl)methyl]-1,3-dioxolan-4-yl]methanol |
|---|---|
| PubChem CID | 115094665 |
| Molecular Formula | C12H16O4 |
| Molecular Weight | 224.26 g/mol |
| Exact Mass | 224.10 |
| IUPAC Name | [2-[(2-methoxyphenyl)methyl]-1,3-dioxolan-4-yl]methanol |
| SMILES | COc1ccccc1CC1OCC(CO)O1 |
| InChI | InChI=1S/C12H16O4/c1-14-11-5-3-2-4-9(11)6-12-15-8-10(7-13)16-12/h2-5,10,12-13H,6-8H2,1H3 |
| InChIKey | ITORJBXOBFQUPG-UHFFFAOYSA-N |
| XLogP | 0.97 |
| TPSA | 47.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.26 |
| LogP ≤ 5 | 0.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |