C21H27NO5 — CID 11037922
N-[[(2S,4S)-2-benzyl-1,3-dioxolan-4-yl]methyl]-2-(2,6-dimethoxyphenoxy)ethanamine (PubChem CID 11037922) has the molecular formula C21H27NO5 and a molecular weight of 373.45 g/mol. Its IUPAC name is N-[[(2S,4S)-2-benzyl-1,3-dioxolan-4-yl]methyl]-2-(2,6-dimethoxyphenoxy)ethanamine.
| Compound Name | N-[[(2S,4S)-2-benzyl-1,3-dioxolan-4-yl]methyl]-2-(2,6-dimethoxyphenoxy)ethanamine |
|---|---|
| PubChem CID | 11037922 |
| Molecular Formula | C21H27NO5 |
| Molecular Weight | 373.45 g/mol |
| Exact Mass | 373.19 |
| IUPAC Name | N-[[(2S,4S)-2-benzyl-1,3-dioxolan-4-yl]methyl]-2-(2,6-dimethoxyphenoxy)ethanamine |
| SMILES | COc1cccc(OC)c1OCCNC[C@H]1CO[C@H](Cc2ccccc2)O1 |
| InChI | InChI=1S/C21H27NO5/c1-23-18-9-6-10-19(24-2)21(18)25-12-11-22-14-17-15-26-20(27-17)13-16-7-4-3-5-8-16/h3-10,17,20,22H,11-15H2,1-2H3/t17-,20-/m0/s1 |
| InChIKey | RIVVOSUHDSFWNP-PXNSSMCTSA-N |
| XLogP | 2.66 |
| TPSA | 58.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.45 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|