C19H29NO8 — CID 2923735
4-(2,6-dimethoxyphenoxy)-N-(oxolan-2-ylmethyl)butan-1-amine;oxalic acid (PubChem CID 2923735) has the molecular formula C19H29NO8 and a molecular weight of 399.44 g/mol. Its IUPAC name is 4-(2,6-dimethoxyphenoxy)-N-(oxolan-2-ylmethyl)butan-1-amine;oxalic acid.
| Compound Name | 4-(2,6-dimethoxyphenoxy)-N-(oxolan-2-ylmethyl)butan-1-amine;oxalic acid |
|---|---|
| PubChem CID | 2923735 |
| Molecular Formula | C19H29NO8 |
| Molecular Weight | 399.44 g/mol |
| Exact Mass | 399.19 |
| IUPAC Name | 4-(2,6-dimethoxyphenoxy)-N-(oxolan-2-ylmethyl)butan-1-amine;oxalic acid |
| SMILES | COc1cccc(OC)c1OCCCCNCC1CCCO1.O=C(O)C(=O)O |
| InChI | InChI=1S/C17H27NO4.C2H2O4/c1-19-15-8-5-9-16(20-2)17(15)22-11-4-3-10-18-13-14-7-6-12-21-14;3-1(4)2(5)6/h5,8-9,14,18H,3-4,6-7,10-13H2,1-2H3;(H,3,4)(H,5,6) |
| InChIKey | SAYCHWJEAZSMIG-UHFFFAOYSA-N |
| XLogP | 1.79 |
| TPSA | 123.55 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.44 |
| LogP ≤ 5 | 1.79 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|