C17H28ClNO3 — CID 2995705
2-(2-butoxyphenoxy)-N-(oxolan-2-ylmethyl)ethanamine;hydrochloride (PubChem CID 2995705) has the molecular formula C17H28ClNO3 and a molecular weight of 329.87 g/mol. Its IUPAC name is 2-(2-butoxyphenoxy)-N-(oxolan-2-ylmethyl)ethanamine;hydrochloride.
| Compound Name | 2-(2-butoxyphenoxy)-N-(oxolan-2-ylmethyl)ethanamine;hydrochloride |
|---|---|
| PubChem CID | 2995705 |
| Molecular Formula | C17H28ClNO3 |
| Molecular Weight | 329.87 g/mol |
| Exact Mass | 329.18 |
| IUPAC Name | 2-(2-butoxyphenoxy)-N-(oxolan-2-ylmethyl)ethanamine;hydrochloride |
| SMILES | CCCCOc1ccccc1OCCNCC1CCCO1.Cl |
| InChI | InChI=1S/C17H27NO3.ClH/c1-2-3-11-20-16-8-4-5-9-17(16)21-13-10-18-14-15-7-6-12-19-15;/h4-5,8-9,15,18H,2-3,6-7,10-14H2,1H3;1H |
| InChIKey | KFPQJVBICMKRGS-UHFFFAOYSA-N |
| XLogP | 3.43 |
| TPSA | 39.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.87 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|