C13H17F2NO2 — CID 81269052
2-(2,6-difluorophenoxy)-N-(oxolan-2-ylmethyl)ethanamine (PubChem CID 81269052) has the molecular formula C13H17F2NO2 and a molecular weight of 257.28 g/mol. Its IUPAC name is 2-(2,6-difluorophenoxy)-N-(oxolan-2-ylmethyl)ethanamine.
| Compound Name | 2-(2,6-difluorophenoxy)-N-(oxolan-2-ylmethyl)ethanamine |
|---|---|
| PubChem CID | 81269052 |
| Molecular Formula | C13H17F2NO2 |
| Molecular Weight | 257.28 g/mol |
| Exact Mass | 257.12 |
| IUPAC Name | 2-(2,6-difluorophenoxy)-N-(oxolan-2-ylmethyl)ethanamine |
| SMILES | Fc1cccc(F)c1OCCNCC1CCCO1 |
| InChI | InChI=1S/C13H17F2NO2/c14-11-4-1-5-12(15)13(11)18-8-6-16-9-10-3-2-7-17-10/h1,4-5,10,16H,2-3,6-9H2 |
| InChIKey | DONPTQVFUGIHIF-UHFFFAOYSA-N |
| XLogP | 2.11 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.28 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|