C20H25NO5 — CID 14183462
(3S,4R)-3-[[2-(2,6-dimethoxyphenoxy)ethylamino]methyl]-3,4-dihydro-2H-chromen-4-ol (PubChem CID 14183462) has the molecular formula C20H25NO5 and a molecular weight of 359.42 g/mol. Its IUPAC name is (3S,4R)-3-[[2-(2,6-dimethoxyphenoxy)ethylamino]methyl]-3,4-dihydro-2H-chromen-4-ol.
| Compound Name | (3S,4R)-3-[[2-(2,6-dimethoxyphenoxy)ethylamino]methyl]-3,4-dihydro-2H-chromen-4-ol |
|---|---|
| PubChem CID | 14183462 |
| Molecular Formula | C20H25NO5 |
| Molecular Weight | 359.42 g/mol |
| Exact Mass | 359.17 |
| IUPAC Name | (3S,4R)-3-[[2-(2,6-dimethoxyphenoxy)ethylamino]methyl]-3,4-dihydro-2H-chromen-4-ol |
| SMILES | COc1cccc(OC)c1OCCNC[C@H]1COc2ccccc2[C@@H]1O |
| InChI | InChI=1S/C20H25NO5/c1-23-17-8-5-9-18(24-2)20(17)25-11-10-21-12-14-13-26-16-7-4-3-6-15(16)19(14)22/h3-9,14,19,21-22H,10-13H2,1-2H3/t14-,19+/m0/s1 |
| InChIKey | BNRLKFFGYHKKQM-IFXJQAMLSA-N |
| XLogP | 2.41 |
| TPSA | 69.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.42 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|