C27H29NO4 — CID 10071410
(2S,4R)-2-[[2-(2,6-dimethoxyphenoxy)ethylamino]methyl]-4-phenyl-3,4-dihydro-2H-naphthalen-1-one (PubChem CID 10071410) has the molecular formula C27H29NO4 and a molecular weight of 431.53 g/mol. Its IUPAC name is (2S,4R)-2-[[2-(2,6-dimethoxyphenoxy)ethylamino]methyl]-4-phenyl-3,4-dihydro-2H-naphthalen-1-one.
| Compound Name | (2S,4R)-2-[[2-(2,6-dimethoxyphenoxy)ethylamino]methyl]-4-phenyl-3,4-dihydro-2H-naphthalen-1-one |
|---|---|
| PubChem CID | 10071410 |
| Molecular Formula | C27H29NO4 |
| Molecular Weight | 431.53 g/mol |
| Exact Mass | 431.21 |
| IUPAC Name | (2S,4R)-2-[[2-(2,6-dimethoxyphenoxy)ethylamino]methyl]-4-phenyl-3,4-dihydro-2H-naphthalen-1-one |
| SMILES | COc1cccc(OC)c1OCCNC[C@@H]1C[C@H](c2ccccc2)c2ccccc2C1=O |
| InChI | InChI=1S/C27H29NO4/c1-30-24-13-8-14-25(31-2)27(24)32-16-15-28-18-20-17-23(19-9-4-3-5-10-19)21-11-6-7-12-22(21)26(20)29/h3-14,20,23,28H,15-18H2,1-2H3/t20-,23+/m0/s1 |
| InChIKey | UZPNDQMXOWZSMG-NZQKXSOJSA-N |
| XLogP | 4.71 |
| TPSA | 56.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.53 |
| LogP ≤ 5 | 4.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|