C18H16O2 — CID 102165445
2-acetyl-4-phenyl-3,4-dihydro-2H-naphthalen-1-one (PubChem CID 102165445) has the molecular formula C18H16O2 and a molecular weight of 264.32 g/mol. Its IUPAC name is 2-acetyl-4-phenyl-3,4-dihydro-2H-naphthalen-1-one.
| Compound Name | 2-acetyl-4-phenyl-3,4-dihydro-2H-naphthalen-1-one |
|---|---|
| PubChem CID | 102165445 |
| Molecular Formula | C18H16O2 |
| Molecular Weight | 264.32 g/mol |
| Exact Mass | 264.12 |
| IUPAC Name | 2-acetyl-4-phenyl-3,4-dihydro-2H-naphthalen-1-one |
| SMILES | CC(=O)C1CC(c2ccccc2)c2ccccc2C1=O |
| InChI | InChI=1S/C18H16O2/c1-12(19)16-11-17(13-7-3-2-4-8-13)14-9-5-6-10-15(14)18(16)20/h2-10,16-17H,11H2,1H3 |
| InChIKey | ZDEUFYHNKFBLRW-UHFFFAOYSA-N |
| XLogP | 3.61 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.32 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|