C16H14O — CID 102253511
1-[(9R)-9,10-dihydrophenanthren-9-yl]ethanone (PubChem CID 102253511) has the molecular formula C16H14O and a molecular weight of 222.29 g/mol. Its IUPAC name is 1-[(9R)-9,10-dihydrophenanthren-9-yl]ethanone.
| Compound Name | 1-[(9R)-9,10-dihydrophenanthren-9-yl]ethanone |
|---|---|
| PubChem CID | 102253511 |
| Molecular Formula | C16H14O |
| Molecular Weight | 222.29 g/mol |
| Exact Mass | 222.10 |
| IUPAC Name | 1-[(9R)-9,10-dihydrophenanthren-9-yl]ethanone |
| SMILES | CC(=O)[C@@H]1Cc2ccccc2-c2ccccc21 |
| InChI | InChI=1S/C16H14O/c1-11(17)16-10-12-6-2-3-7-13(12)14-8-4-5-9-15(14)16/h2-9,16H,10H2,1H3/t16-/m0/s1 |
| InChIKey | PSLYGHANIHJZCO-INIZCTEOSA-N |
| XLogP | 3.58 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.29 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |