C16H15NO2 — CID 154254625
3-methoxy-9,10-dihydrophenanthrene-9-carboxamide (PubChem CID 154254625) has the molecular formula C16H15NO2 and a molecular weight of 253.30 g/mol. Its IUPAC name is 3-methoxy-9,10-dihydrophenanthrene-9-carboxamide.
| Compound Name | 3-methoxy-9,10-dihydrophenanthrene-9-carboxamide |
|---|---|
| PubChem CID | 154254625 |
| Molecular Formula | C16H15NO2 |
| Molecular Weight | 253.30 g/mol |
| Exact Mass | 253.11 |
| IUPAC Name | 3-methoxy-9,10-dihydrophenanthrene-9-carboxamide |
| SMILES | COc1ccc2c(c1)-c1ccccc1C(C(N)=O)C2 |
| InChI | InChI=1S/C16H15NO2/c1-19-11-7-6-10-8-15(16(17)18)13-5-3-2-4-12(13)14(10)9-11/h2-7,9,15H,8H2,1H3,(H2,17,18) |
| InChIKey | SBPPHIDMOVFEKB-UHFFFAOYSA-N |
| XLogP | 2.49 |
| TPSA | 52.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.30 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |