C17H16O4 — CID 70535600
2,3-dimethoxy-9,10-dihydrophenanthrene-9-carboxylic acid (PubChem CID 70535600) has the molecular formula C17H16O4 and a molecular weight of 284.31 g/mol. Its IUPAC name is 2,3-dimethoxy-9,10-dihydrophenanthrene-9-carboxylic acid.
| Compound Name | 2,3-dimethoxy-9,10-dihydrophenanthrene-9-carboxylic acid |
|---|---|
| PubChem CID | 70535600 |
| Molecular Formula | C17H16O4 |
| Molecular Weight | 284.31 g/mol |
| Exact Mass | 284.10 |
| IUPAC Name | 2,3-dimethoxy-9,10-dihydrophenanthrene-9-carboxylic acid |
| SMILES | COc1cc2c(cc1OC)-c1ccccc1C(C(=O)O)C2 |
| InChI | InChI=1S/C17H16O4/c1-20-15-8-10-7-14(17(18)19)12-6-4-3-5-11(12)13(10)9-16(15)21-2/h3-6,8-9,14H,7H2,1-2H3,(H,18,19) |
| InChIKey | ITIJIPSMKRZZJD-UHFFFAOYSA-N |
| XLogP | 3.10 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.31 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |