C24H22NO4+ — CID 98114223
(2S)-2-(1-benzylpyridin-1-ium-4-carbonyl)-5,6-dimethoxy-2,3-dihydroinden-1-one (PubChem CID 98114223) has the molecular formula C24H22NO4+ and a molecular weight of 388.44 g/mol. Its IUPAC name is (2S)-2-(1-benzylpyridin-1-ium-4-carbonyl)-5,6-dimethoxy-2,3-dihydroinden-1-one.
| Compound Name | (2S)-2-(1-benzylpyridin-1-ium-4-carbonyl)-5,6-dimethoxy-2,3-dihydroinden-1-one |
|---|---|
| PubChem CID | 98114223 |
| Molecular Formula | C24H22NO4+ |
| Molecular Weight | 388.44 g/mol |
| Exact Mass | 388.15 |
| IUPAC Name | (2S)-2-(1-benzylpyridin-1-ium-4-carbonyl)-5,6-dimethoxy-2,3-dihydroinden-1-one |
| SMILES | COc1cc2c(cc1OC)C(=O)[C@H](C(=O)c1cc[n+](Cc3ccccc3)cc1)C2 |
| InChI | InChI=1S/C24H22NO4/c1-28-21-13-18-12-20(24(27)19(18)14-22(21)29-2)23(26)17-8-10-25(11-9-17)15-16-6-4-3-5-7-16/h3-11,13-14,20H,12,15H2,1-2H3/q+1/t20-/m0/s1 |
| InChIKey | ZNLMYKRSABSJFZ-FQEVSTJZSA-N |
| XLogP | 3.28 |
| TPSA | 56.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.44 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|