C16H11FO2 — CID 116531409
2-benzoyl-5-fluoro-2,3-dihydroinden-1-one (PubChem CID 116531409) has the molecular formula C16H11FO2 and a molecular weight of 254.26 g/mol. Its IUPAC name is 2-benzoyl-5-fluoro-2,3-dihydroinden-1-one.
| Compound Name | 2-benzoyl-5-fluoro-2,3-dihydroinden-1-one |
|---|---|
| PubChem CID | 116531409 |
| Molecular Formula | C16H11FO2 |
| Molecular Weight | 254.26 g/mol |
| Exact Mass | 254.07 |
| IUPAC Name | 2-benzoyl-5-fluoro-2,3-dihydroinden-1-one |
| SMILES | O=C(c1ccccc1)C1Cc2cc(F)ccc2C1=O |
| InChI | InChI=1S/C16H11FO2/c17-12-6-7-13-11(8-12)9-14(16(13)19)15(18)10-4-2-1-3-5-10/h1-8,14H,9H2 |
| InChIKey | QUTLIUSOVFNBLK-UHFFFAOYSA-N |
| XLogP | 3.06 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.26 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|