C17H14FNO2 — CID 134118733
N-(6-fluoro-3-oxo-1,2-dihydroinden-2-yl)-N-methylbenzamide (PubChem CID 134118733) has the molecular formula C17H14FNO2 and a molecular weight of 283.30 g/mol. Its IUPAC name is N-(6-fluoro-3-oxo-1,2-dihydroinden-2-yl)-N-methylbenzamide.
| Compound Name | N-(6-fluoro-3-oxo-1,2-dihydroinden-2-yl)-N-methylbenzamide |
|---|---|
| PubChem CID | 134118733 |
| Molecular Formula | C17H14FNO2 |
| Molecular Weight | 283.30 g/mol |
| Exact Mass | 283.10 |
| IUPAC Name | N-(6-fluoro-3-oxo-1,2-dihydroinden-2-yl)-N-methylbenzamide |
| SMILES | CN(C(=O)c1ccccc1)C1Cc2cc(F)ccc2C1=O |
| InChI | InChI=1S/C17H14FNO2/c1-19(17(21)11-5-3-2-4-6-11)15-10-12-9-13(18)7-8-14(12)16(15)20/h2-9,15H,10H2,1H3 |
| InChIKey | ZVXLODDMINVWJE-UHFFFAOYSA-N |
| XLogP | 2.71 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.30 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |