C25H18F4N4O4 — CID 134093638
N-[(3E)-3-[(2,2-difluoro-1,3-benzodioxol-5-yl)carbamoylhydrazinylidene]-6-fluoro-1,2-dihydroinden-2-yl]-4-fluoro-N-methylbenzamide (PubChem CID 134093638) has the molecular formula C25H18F4N4O4 and a molecular weight of 514.44 g/mol. Its IUPAC name is N-[(3E)-3-[(2,2-difluoro-1,3-benzodioxol-5-yl)carbamoylhydrazinylidene]-6-fluoro-1,2-dihydroinden-2-yl]-4-fluoro-N-methylbenzamide.
| Compound Name | N-[(3E)-3-[(2,2-difluoro-1,3-benzodioxol-5-yl)carbamoylhydrazinylidene]-6-fluoro-1,2-dihydroinden-2-yl]-4-fluoro-N-methylbenzamide |
|---|---|
| PubChem CID | 134093638 |
| Molecular Formula | C25H18F4N4O4 |
| Molecular Weight | 514.44 g/mol |
| Exact Mass | 514.13 |
| IUPAC Name | N-[(3E)-3-[(2,2-difluoro-1,3-benzodioxol-5-yl)carbamoylhydrazinylidene]-6-fluoro-1,2-dihydroinden-2-yl]-4-fluoro-N-methylbenzamide |
| SMILES | CN(C(=O)c1ccc(F)cc1)C1Cc2cc(F)ccc2/C1=N\NC(=O)Nc1ccc2c(c1)OC(F)(F)O2 |
| InChI | InChI=1S/C25H18F4N4O4/c1-33(23(34)13-2-4-15(26)5-3-13)19-11-14-10-16(27)6-8-18(14)22(19)31-32-24(35)30-17-7-9-20-21(12-17)37-25(28,29)36-20/h2-10,12,19H,11H2,1H3,(H2,30,32,35)/b31-22+ |
| InChIKey | SQANFYKSLRBLCF-DFKUXCBWSA-N |
| XLogP | 4.51 |
| TPSA | 92.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 514.44 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|