C14H9ClF2N2O3 — CID 132846933
1-(3-chlorophenyl)-3-(2,2-difluoro-1,3-benzodioxol-5-yl)urea (PubChem CID 132846933) has the molecular formula C14H9ClF2N2O3 and a molecular weight of 326.69 g/mol. Its IUPAC name is 1-(3-chlorophenyl)-3-(2,2-difluoro-1,3-benzodioxol-5-yl)urea.
| Compound Name | 1-(3-chlorophenyl)-3-(2,2-difluoro-1,3-benzodioxol-5-yl)urea |
|---|---|
| PubChem CID | 132846933 |
| Molecular Formula | C14H9ClF2N2O3 |
| Molecular Weight | 326.69 g/mol |
| Exact Mass | 326.03 |
| IUPAC Name | 1-(3-chlorophenyl)-3-(2,2-difluoro-1,3-benzodioxol-5-yl)urea |
| SMILES | O=C(Nc1cccc(Cl)c1)Nc1ccc2c(c1)OC(F)(F)O2 |
| InChI | InChI=1S/C14H9ClF2N2O3/c15-8-2-1-3-9(6-8)18-13(20)19-10-4-5-11-12(7-10)22-14(16,17)21-11/h1-7H,(H2,18,19,20) |
| InChIKey | GABNLSIXBJRDQX-UHFFFAOYSA-N |
| XLogP | 4.31 |
| TPSA | 59.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.69 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |