C11H9FO3 — CID 175010012
(6-fluoro-3-oxo-1,2-dihydroinden-2-yl) acetate (PubChem CID 175010012) has the molecular formula C11H9FO3 and a molecular weight of 208.19 g/mol. Its IUPAC name is (6-fluoro-3-oxo-1,2-dihydroinden-2-yl) acetate.
| Compound Name | (6-fluoro-3-oxo-1,2-dihydroinden-2-yl) acetate |
|---|---|
| PubChem CID | 175010012 |
| Molecular Formula | C11H9FO3 |
| Molecular Weight | 208.19 g/mol |
| Exact Mass | 208.05 |
| IUPAC Name | (6-fluoro-3-oxo-1,2-dihydroinden-2-yl) acetate |
| SMILES | CC(=O)OC1Cc2cc(F)ccc2C1=O |
| InChI | InChI=1S/C11H9FO3/c1-6(13)15-10-5-7-4-8(12)2-3-9(7)11(10)14/h2-4,10H,5H2,1H3 |
| InChIKey | KFORYYVGKZDPEM-UHFFFAOYSA-N |
| XLogP | 1.50 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 208.19 |
| LogP ≤ 5 | 1.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |