C16H13NO2 — CID 154640290
3-benzoyl-3,4-dihydro-1H-quinolin-2-one (PubChem CID 154640290) has the molecular formula C16H13NO2 and a molecular weight of 251.29 g/mol. Its IUPAC name is 3-benzoyl-3,4-dihydro-1H-quinolin-2-one.
| Compound Name | 3-benzoyl-3,4-dihydro-1H-quinolin-2-one |
|---|---|
| PubChem CID | 154640290 |
| Molecular Formula | C16H13NO2 |
| Molecular Weight | 251.29 g/mol |
| Exact Mass | 251.09 |
| IUPAC Name | 3-benzoyl-3,4-dihydro-1H-quinolin-2-one |
| SMILES | O=C1Nc2ccccc2CC1C(=O)c1ccccc1 |
| InChI | InChI=1S/C16H13NO2/c18-15(11-6-2-1-3-7-11)13-10-12-8-4-5-9-14(12)17-16(13)19/h1-9,13H,10H2,(H,17,19) |
| InChIKey | CMRRNGKKEKUHQO-UHFFFAOYSA-N |
| XLogP | 2.68 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.29 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|