C12H12BrNO2 — CID 150552206
3-(3-bromopropanoyl)-3,4-dihydro-1H-quinolin-2-one (PubChem CID 150552206) has the molecular formula C12H12BrNO2 and a molecular weight of 282.14 g/mol. Its IUPAC name is 3-(3-bromopropanoyl)-3,4-dihydro-1H-quinolin-2-one.
| Compound Name | 3-(3-bromopropanoyl)-3,4-dihydro-1H-quinolin-2-one |
|---|---|
| PubChem CID | 150552206 |
| Molecular Formula | C12H12BrNO2 |
| Molecular Weight | 282.14 g/mol |
| Exact Mass | 281.01 |
| IUPAC Name | 3-(3-bromopropanoyl)-3,4-dihydro-1H-quinolin-2-one |
| SMILES | O=C(CCBr)C1Cc2ccccc2NC1=O |
| InChI | InChI=1S/C12H12BrNO2/c13-6-5-11(15)9-7-8-3-1-2-4-10(8)14-12(9)16/h1-4,9H,5-7H2,(H,14,16) |
| InChIKey | IICOHMNVLKUOBE-UHFFFAOYSA-N |
| XLogP | 2.15 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.14 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|