C26H29NO5 — CID 11135150
2-(2,6-dimethoxyphenoxy)-N-[(2,2-diphenyl-1,3-dioxolan-4-yl)methyl]ethanamine (PubChem CID 11135150) has the molecular formula C26H29NO5 and a molecular weight of 435.52 g/mol. Its IUPAC name is 2-(2,6-dimethoxyphenoxy)-N-[(2,2-diphenyl-1,3-dioxolan-4-yl)methyl]ethanamine.
| Compound Name | 2-(2,6-dimethoxyphenoxy)-N-[(2,2-diphenyl-1,3-dioxolan-4-yl)methyl]ethanamine |
|---|---|
| PubChem CID | 11135150 |
| Molecular Formula | C26H29NO5 |
| Molecular Weight | 435.52 g/mol |
| Exact Mass | 435.20 |
| IUPAC Name | 2-(2,6-dimethoxyphenoxy)-N-[(2,2-diphenyl-1,3-dioxolan-4-yl)methyl]ethanamine |
| SMILES | COc1cccc(OC)c1OCCNCC1COC(c2ccccc2)(c2ccccc2)O1 |
| InChI | InChI=1S/C26H29NO5/c1-28-23-14-9-15-24(29-2)25(23)30-17-16-27-18-22-19-31-26(32-22,20-10-5-3-6-11-20)21-12-7-4-8-13-21/h3-15,22,27H,16-19H2,1-2H3 |
| InChIKey | XRTCZMPGERZCKE-UHFFFAOYSA-N |
| XLogP | 3.99 |
| TPSA | 58.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.52 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|