C28H31NO8 — CID 155563001
N-[[(2S,4S)-2-benzhydryl-1,3-dioxolan-4-yl]methyl]-2-(2-methoxyphenoxy)ethanamine;oxalic acid (PubChem CID 155563001) has the molecular formula C28H31NO8 and a molecular weight of 509.56 g/mol. Its IUPAC name is N-[[(2S,4S)-2-benzhydryl-1,3-dioxolan-4-yl]methyl]-2-(2-methoxyphenoxy)ethanamine;oxalic acid.
| Compound Name | N-[[(2S,4S)-2-benzhydryl-1,3-dioxolan-4-yl]methyl]-2-(2-methoxyphenoxy)ethanamine;oxalic acid |
|---|---|
| PubChem CID | 155563001 |
| Molecular Formula | C28H31NO8 |
| Molecular Weight | 509.56 g/mol |
| Exact Mass | 509.20 |
| IUPAC Name | N-[[(2S,4S)-2-benzhydryl-1,3-dioxolan-4-yl]methyl]-2-(2-methoxyphenoxy)ethanamine;oxalic acid |
| SMILES | COc1ccccc1OCCNC[C@H]1CO[C@H](C(c2ccccc2)c2ccccc2)O1.O=C(O)C(=O)O |
| InChI | InChI=1S/C26H29NO4.C2H2O4/c1-28-23-14-8-9-15-24(23)29-17-16-27-18-22-19-30-26(31-22)25(20-10-4-2-5-11-20)21-12-6-3-7-13-21;3-1(4)2(5)6/h2-15,22,25-27H,16-19H2,1H3;(H,3,4)(H,5,6)/t22-,26-;/m0./s1 |
| InChIKey | OWCHNBFFLPYCAL-QHTHEMFPSA-N |
| XLogP | 3.39 |
| TPSA | 123.55 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 509.56 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|