C29H33NO8 — CID 155555858
2-[(2S,4S)-2-benzhydryl-1,3-dioxolan-4-yl]-N-[2-(2-methoxyphenoxy)ethyl]ethanamine;oxalic acid (PubChem CID 155555858) has the molecular formula C29H33NO8 and a molecular weight of 523.58 g/mol. Its IUPAC name is 2-[(2S,4S)-2-benzhydryl-1,3-dioxolan-4-yl]-N-[2-(2-methoxyphenoxy)ethyl]ethanamine;oxalic acid.
| Compound Name | 2-[(2S,4S)-2-benzhydryl-1,3-dioxolan-4-yl]-N-[2-(2-methoxyphenoxy)ethyl]ethanamine;oxalic acid |
|---|---|
| PubChem CID | 155555858 |
| Molecular Formula | C29H33NO8 |
| Molecular Weight | 523.58 g/mol |
| Exact Mass | 523.22 |
| IUPAC Name | 2-[(2S,4S)-2-benzhydryl-1,3-dioxolan-4-yl]-N-[2-(2-methoxyphenoxy)ethyl]ethanamine;oxalic acid |
| SMILES | COc1ccccc1OCCNCC[C@H]1CO[C@H](C(c2ccccc2)c2ccccc2)O1.O=C(O)C(=O)O |
| InChI | InChI=1S/C27H31NO4.C2H2O4/c1-29-24-14-8-9-15-25(24)30-19-18-28-17-16-23-20-31-27(32-23)26(21-10-4-2-5-11-21)22-12-6-3-7-13-22;3-1(4)2(5)6/h2-15,23,26-28H,16-20H2,1H3;(H,3,4)(H,5,6)/t23-,27-;/m0./s1 |
| InChIKey | JLDHKWRQWBBSLH-QAVRJCAVSA-N |
| XLogP | 3.78 |
| TPSA | 123.55 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 523.58 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|