C18H21NO3 — CID 10979460
2-phenoxy-N-[[(2S,4R)-2-phenyl-1,3-dioxolan-4-yl]methyl]ethanamine (PubChem CID 10979460) has the molecular formula C18H21NO3 and a molecular weight of 299.37 g/mol. Its IUPAC name is 2-phenoxy-N-[[(2S,4R)-2-phenyl-1,3-dioxolan-4-yl]methyl]ethanamine.
| Compound Name | 2-phenoxy-N-[[(2S,4R)-2-phenyl-1,3-dioxolan-4-yl]methyl]ethanamine |
|---|---|
| PubChem CID | 10979460 |
| Molecular Formula | C18H21NO3 |
| Molecular Weight | 299.37 g/mol |
| Exact Mass | 299.15 |
| IUPAC Name | 2-phenoxy-N-[[(2S,4R)-2-phenyl-1,3-dioxolan-4-yl]methyl]ethanamine |
| SMILES | c1ccc(OCCNC[C@@H]2CO[C@H](c3ccccc3)O2)cc1 |
| InChI | InChI=1S/C18H21NO3/c1-3-7-15(8-4-1)18-21-14-17(22-18)13-19-11-12-20-16-9-5-2-6-10-16/h1-10,17-19H,11-14H2/t17-,18+/m1/s1 |
| InChIKey | SBYUKHBAZJUFBU-MSOLQXFVSA-N |
| XLogP | 2.77 |
| TPSA | 39.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.37 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|