C19H23NO3 — CID 25130878
2-phenoxy-N-[[(2R,6S)-6-phenyl-1,4-dioxan-2-yl]methyl]ethanamine (PubChem CID 25130878) has the molecular formula C19H23NO3 and a molecular weight of 313.40 g/mol. Its IUPAC name is 2-phenoxy-N-[[(2R,6S)-6-phenyl-1,4-dioxan-2-yl]methyl]ethanamine.
| Compound Name | 2-phenoxy-N-[[(2R,6S)-6-phenyl-1,4-dioxan-2-yl]methyl]ethanamine |
|---|---|
| PubChem CID | 25130878 |
| Molecular Formula | C19H23NO3 |
| Molecular Weight | 313.40 g/mol |
| Exact Mass | 313.17 |
| IUPAC Name | 2-phenoxy-N-[[(2R,6S)-6-phenyl-1,4-dioxan-2-yl]methyl]ethanamine |
| SMILES | c1ccc(OCCNC[C@@H]2COC[C@H](c3ccccc3)O2)cc1 |
| InChI | InChI=1S/C19H23NO3/c1-3-7-16(8-4-1)19-15-21-14-18(23-19)13-20-11-12-22-17-9-5-2-6-10-17/h1-10,18-20H,11-15H2/t18-,19-/m1/s1 |
| InChIKey | ZUVHIOFWBBSJDZ-RTBURBONSA-N |
| XLogP | 2.81 |
| TPSA | 39.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.40 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|