C19H21NO4 — CID 25132912
(2S,6R)-N-(2-phenoxyethyl)-6-phenyl-1,4-dioxane-2-carboxamide (PubChem CID 25132912) has the molecular formula C19H21NO4 and a molecular weight of 327.38 g/mol. Its IUPAC name is (2S,6R)-N-(2-phenoxyethyl)-6-phenyl-1,4-dioxane-2-carboxamide.
| Compound Name | (2S,6R)-N-(2-phenoxyethyl)-6-phenyl-1,4-dioxane-2-carboxamide |
|---|---|
| PubChem CID | 25132912 |
| Molecular Formula | C19H21NO4 |
| Molecular Weight | 327.38 g/mol |
| Exact Mass | 327.15 |
| IUPAC Name | (2S,6R)-N-(2-phenoxyethyl)-6-phenyl-1,4-dioxane-2-carboxamide |
| SMILES | O=C(NCCOc1ccccc1)[C@@H]1COC[C@@H](c2ccccc2)O1 |
| InChI | InChI=1S/C19H21NO4/c21-19(20-11-12-23-16-9-5-2-6-10-16)18-14-22-13-17(24-18)15-7-3-1-4-8-15/h1-10,17-18H,11-14H2,(H,20,21)/t17-,18-/m0/s1 |
| InChIKey | SMQWSAQBVSSWLT-ROUUACIJSA-N |
| XLogP | 2.34 |
| TPSA | 56.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.38 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|