C18H19ClO4 — CID 40562654
(2R,4R)-2-(4-chlorophenyl)-4-(2-phenoxyethoxymethyl)-1,3-dioxolane (PubChem CID 40562654) has the molecular formula C18H19ClO4 and a molecular weight of 334.80 g/mol. Its IUPAC name is (2R,4R)-2-(4-chlorophenyl)-4-(2-phenoxyethoxymethyl)-1,3-dioxolane.
| Compound Name | (2R,4R)-2-(4-chlorophenyl)-4-(2-phenoxyethoxymethyl)-1,3-dioxolane |
|---|---|
| PubChem CID | 40562654 |
| Molecular Formula | C18H19ClO4 |
| Molecular Weight | 334.80 g/mol |
| Exact Mass | 334.10 |
| IUPAC Name | (2R,4R)-2-(4-chlorophenyl)-4-(2-phenoxyethoxymethyl)-1,3-dioxolane |
| SMILES | Clc1ccc([C@@H]2OC[C@@H](COCCOc3ccccc3)O2)cc1 |
| InChI | InChI=1S/C18H19ClO4/c19-15-8-6-14(7-9-15)18-22-13-17(23-18)12-20-10-11-21-16-4-2-1-3-5-16/h1-9,17-18H,10-13H2/t17-,18-/m1/s1 |
| InChIKey | UYYDKQBZXCFHNT-QZTJIDSGSA-N |
| XLogP | 3.85 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.80 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|