C13H15ClO3 — CID 40532289
(2R,4S)-2-(4-chlorophenyl)-4-(prop-2-enoxymethyl)-1,3-dioxolane (PubChem CID 40532289) has the molecular formula C13H15ClO3 and a molecular weight of 254.71 g/mol. Its IUPAC name is (2R,4S)-2-(4-chlorophenyl)-4-(prop-2-enoxymethyl)-1,3-dioxolane.
| Compound Name | (2R,4S)-2-(4-chlorophenyl)-4-(prop-2-enoxymethyl)-1,3-dioxolane |
|---|---|
| PubChem CID | 40532289 |
| Molecular Formula | C13H15ClO3 |
| Molecular Weight | 254.71 g/mol |
| Exact Mass | 254.07 |
| IUPAC Name | (2R,4S)-2-(4-chlorophenyl)-4-(prop-2-enoxymethyl)-1,3-dioxolane |
| SMILES | C=CCOC[C@H]1CO[C@@H](c2ccc(Cl)cc2)O1 |
| InChI | InChI=1S/C13H15ClO3/c1-2-7-15-8-12-9-16-13(17-12)10-3-5-11(14)6-4-10/h2-6,12-13H,1,7-9H2/t12-,13+/m0/s1 |
| InChIKey | BPIMUDWIBMXRGS-QWHCGFSZSA-N |
| XLogP | 2.96 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.71 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|