C12H15NO3 — CID 86612852
N-methyl-2-[2-[[(2S)-oxiran-2-yl]methoxy]phenyl]acetamide (PubChem CID 86612852) has the molecular formula C12H15NO3 and a molecular weight of 221.26 g/mol. Its IUPAC name is N-methyl-2-[2-[[(2S)-oxiran-2-yl]methoxy]phenyl]acetamide.
| Compound Name | N-methyl-2-[2-[[(2S)-oxiran-2-yl]methoxy]phenyl]acetamide |
|---|---|
| PubChem CID | 86612852 |
| Molecular Formula | C12H15NO3 |
| Molecular Weight | 221.26 g/mol |
| Exact Mass | 221.11 |
| IUPAC Name | N-methyl-2-[2-[[(2S)-oxiran-2-yl]methoxy]phenyl]acetamide |
| SMILES | CNC(=O)Cc1ccccc1OC[C@@H]1CO1 |
| InChI | InChI=1S/C12H15NO3/c1-13-12(14)6-9-4-2-3-5-11(9)16-8-10-7-15-10/h2-5,10H,6-8H2,1H3,(H,13,14)/t10-/m0/s1 |
| InChIKey | OXRQVHYJMWBDKJ-JTQLQIEISA-N |
| XLogP | 0.75 |
| TPSA | 50.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 221.26 |
| LogP ≤ 5 | 0.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|