C11H14O4 — CID 86810362
[2-(1,3-dioxolan-4-ylmethoxy)phenyl]methanol (PubChem CID 86810362) has the molecular formula C11H14O4 and a molecular weight of 210.23 g/mol. Its IUPAC name is [2-(1,3-dioxolan-4-ylmethoxy)phenyl]methanol.
| Compound Name | [2-(1,3-dioxolan-4-ylmethoxy)phenyl]methanol |
|---|---|
| PubChem CID | 86810362 |
| Molecular Formula | C11H14O4 |
| Molecular Weight | 210.23 g/mol |
| Exact Mass | 210.09 |
| IUPAC Name | [2-(1,3-dioxolan-4-ylmethoxy)phenyl]methanol |
| SMILES | OCc1ccccc1OCC1COCO1 |
| InChI | InChI=1S/C11H14O4/c12-5-9-3-1-2-4-11(9)14-7-10-6-13-8-15-10/h1-4,10,12H,5-8H2 |
| InChIKey | ZOVHPPFQNMMRER-UHFFFAOYSA-N |
| XLogP | 0.93 |
| TPSA | 47.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 210.23 |
| LogP ≤ 5 | 0.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |