C14H18O2 — CID 101312440
2-[[2-[(E)-pent-2-enyl]phenoxy]methyl]oxirane (PubChem CID 101312440) has the molecular formula C14H18O2 and a molecular weight of 218.30 g/mol. Its IUPAC name is 2-[[2-[(E)-pent-2-enyl]phenoxy]methyl]oxirane.
| Compound Name | 2-[[2-[(E)-pent-2-enyl]phenoxy]methyl]oxirane |
|---|---|
| PubChem CID | 101312440 |
| Molecular Formula | C14H18O2 |
| Molecular Weight | 218.30 g/mol |
| Exact Mass | 218.13 |
| IUPAC Name | 2-[[2-[(E)-pent-2-enyl]phenoxy]methyl]oxirane |
| SMILES | CC/C=C/Cc1ccccc1OCC1CO1 |
| InChI | InChI=1S/C14H18O2/c1-2-3-4-7-12-8-5-6-9-14(12)16-11-13-10-15-13/h3-6,8-9,13H,2,7,10-11H2,1H3/b4-3+ |
| InChIKey | HNHFRTOWZVLBKI-ONEGZZNKSA-N |
| XLogP | 2.97 |
| TPSA | 21.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 218.30 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|