C18H23ClO4 — CID 88608040
2-(1-chloroprop-2-enoxymethyl)oxirane;2-[(2-prop-2-enylphenoxy)methyl]oxirane (PubChem CID 88608040) has the molecular formula C18H23ClO4 and a molecular weight of 338.83 g/mol. Its IUPAC name is 2-(1-chloroprop-2-enoxymethyl)oxirane;2-[(2-prop-2-enylphenoxy)methyl]oxirane.
| Compound Name | 2-(1-chloroprop-2-enoxymethyl)oxirane;2-[(2-prop-2-enylphenoxy)methyl]oxirane |
|---|---|
| PubChem CID | 88608040 |
| Molecular Formula | C18H23ClO4 |
| Molecular Weight | 338.83 g/mol |
| Exact Mass | 338.13 |
| IUPAC Name | 2-(1-chloroprop-2-enoxymethyl)oxirane;2-[(2-prop-2-enylphenoxy)methyl]oxirane |
| SMILES | C=CC(Cl)OCC1CO1.C=CCc1ccccc1OCC1CO1 |
| InChI | InChI=1S/C12H14O2.C6H9ClO2/c1-2-5-10-6-3-4-7-12(10)14-9-11-8-13-11;1-2-6(7)9-4-5-3-8-5/h2-4,6-7,11H,1,5,8-9H2;2,5-6H,1,3-4H2 |
| InChIKey | FTULFZGDNUXZHG-UHFFFAOYSA-N |
| XLogP | 3.35 |
| TPSA | 43.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.83 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|