C19H12ClN3OS — CID 165383016
N-[2-(2,1,3-benzothiadiazol-4-yl)-6-chlorophenyl]benzamide (PubChem CID 165383016) has the molecular formula C19H12ClN3OS and a molecular weight of 365.85 g/mol. Its IUPAC name is N-[2-(2,1,3-benzothiadiazol-4-yl)-6-chlorophenyl]benzamide.
| Compound Name | N-[2-(2,1,3-benzothiadiazol-4-yl)-6-chlorophenyl]benzamide |
|---|---|
| PubChem CID | 165383016 |
| Molecular Formula | C19H12ClN3OS |
| Molecular Weight | 365.85 g/mol |
| Exact Mass | 365.04 |
| IUPAC Name | N-[2-(2,1,3-benzothiadiazol-4-yl)-6-chlorophenyl]benzamide |
| SMILES | O=C(Nc1c(Cl)cccc1-c1cccc2nsnc12)c1ccccc1 |
| InChI | InChI=1S/C19H12ClN3OS/c20-15-10-4-8-13(14-9-5-11-16-18(14)23-25-22-16)17(15)21-19(24)12-6-2-1-3-7-12/h1-11H,(H,21,24) |
| InChIKey | IDKSXQGTKWCDMI-UHFFFAOYSA-N |
| XLogP | 5.26 |
| TPSA | 54.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.85 |
| LogP ≤ 5 | 5.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |