C13H22N2 — CID 129283902
N'-(2,3-dimethylphenyl)pentane-1,5-diamine (PubChem CID 129283902) has the molecular formula C13H22N2 and a molecular weight of 206.33 g/mol. Its IUPAC name is N'-(2,3-dimethylphenyl)pentane-1,5-diamine.
| Compound Name | N'-(2,3-dimethylphenyl)pentane-1,5-diamine |
|---|---|
| PubChem CID | 129283902 |
| Molecular Formula | C13H22N2 |
| Molecular Weight | 206.33 g/mol |
| Exact Mass | 206.18 |
| IUPAC Name | N'-(2,3-dimethylphenyl)pentane-1,5-diamine |
| SMILES | Cc1cccc(NCCCCCN)c1C |
| InChI | InChI=1S/C13H22N2/c1-11-7-6-8-13(12(11)2)15-10-5-3-4-9-14/h6-8,15H,3-5,9-10,14H2,1-2H3 |
| InChIKey | QGPIMNNNKPOJHG-UHFFFAOYSA-N |
| XLogP | 2.84 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 206.33 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|